C20H17Cl2FN2O2 — CID 137290814
2-[4-(2,6-dichlorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-4-fluorophenol (PubChem CID 137290814) has the molecular formula C20H17Cl2FN2O2 and a molecular weight of 407.27 g/mol. Its IUPAC name is 2-[4-(2,6-dichlorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-4-fluorophenol.
| Compound Name | 2-[4-(2,6-dichlorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-4-fluorophenol |
|---|---|
| PubChem CID | 137290814 |
| Molecular Formula | C20H17Cl2FN2O2 |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-[4-(2,6-dichlorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-4-fluorophenol |
| SMILES | OCCCNc1cc(-c2c(Cl)cccc2Cl)cc(-c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C20H17Cl2FN2O2/c21-15-3-1-4-16(22)20(15)12-9-17(14-11-13(23)5-6-18(14)27)25-19(10-12)24-7-2-8-26/h1,3-6,9-11,26-27H,2,7-8H2,(H,24,25) |
| InChIKey | DWUJXPVUTMNDDX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|