C22H21Cl2N3O2 — CID 137290835
N-[2-[[4-(2,6-dichlorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 137290835) has the molecular formula C22H21Cl2N3O2 and a molecular weight of 430.34 g/mol. Its IUPAC name is N-[2-[[4-(2,6-dichlorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[4-(2,6-dichlorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 137290835 |
| Molecular Formula | C22H21Cl2N3O2 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | N-[2-[[4-(2,6-dichlorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(-c2c(Cl)cccc2Cl)cc(-c2cc(C)ccc2O)n1 |
| InChI | InChI=1S/C22H21Cl2N3O2/c1-13-6-7-20(29)16(10-13)19-11-15(22-17(23)4-3-5-18(22)24)12-21(27-19)26-9-8-25-14(2)28/h3-7,10-12,29H,8-9H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | SSEJJFKTDRJKNR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|