C25H29N3OS — CID 137290748
4-methyl-2-[4-(4-methylsulfanylphenyl)-6-(2-pyrrolidin-1-ylethylamino)-2-pyridinyl]phenol (PubChem CID 137290748) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is 4-methyl-2-[4-(4-methylsulfanylphenyl)-6-(2-pyrrolidin-1-ylethylamino)-2-pyridinyl]phenol.
| Compound Name | 4-methyl-2-[4-(4-methylsulfanylphenyl)-6-(2-pyrrolidin-1-ylethylamino)-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 137290748 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 4-methyl-2-[4-(4-methylsulfanylphenyl)-6-(2-pyrrolidin-1-ylethylamino)-2-pyridinyl]phenol |
| SMILES | CSc1ccc(-c2cc(NCCN3CCCC3)nc(-c3cc(C)ccc3O)c2)cc1 |
| InChI | InChI=1S/C25H29N3OS/c1-18-5-10-24(29)22(15-18)23-16-20(19-6-8-21(30-2)9-7-19)17-25(27-23)26-11-14-28-12-3-4-13-28/h5-10,15-17,29H,3-4,11-14H2,1-2H3,(H,26,27) |
| InChIKey | ARLDKNTVKIKNBR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |