C25H25Cl2N3O2 — CID 137290843
1-[3-[[4-(2,6-dichlorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]propyl]pyrrolidin-2-one (PubChem CID 137290843) has the molecular formula C25H25Cl2N3O2 and a molecular weight of 470.40 g/mol. Its IUPAC name is 1-[3-[[4-(2,6-dichlorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[4-(2,6-dichlorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 137290843 |
| Molecular Formula | C25H25Cl2N3O2 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 1-[3-[[4-(2,6-dichlorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]propyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(O)c(-c2cc(-c3c(Cl)cccc3Cl)cc(NCCCN3CCCC3=O)n2)c1 |
| InChI | InChI=1S/C25H25Cl2N3O2/c1-16-8-9-22(31)18(13-16)21-14-17(25-19(26)5-2-6-20(25)27)15-23(29-21)28-10-4-12-30-11-3-7-24(30)32/h2,5-6,8-9,13-15,31H,3-4,7,10-12H2,1H3,(H,28,29) |
| InChIKey | SCINLXCSZUUWQQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|