C26H26N4O3 — CID 137306931
4-[2-(2-hydroxy-5-methoxyphenyl)-6-[3-(2-oxopyrrolidin-1-yl)propylamino]-4-pyridinyl]benzonitrile (PubChem CID 137306931) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-[2-(2-hydroxy-5-methoxyphenyl)-6-[3-(2-oxopyrrolidin-1-yl)propylamino]-4-pyridinyl]benzonitrile.
| Compound Name | 4-[2-(2-hydroxy-5-methoxyphenyl)-6-[3-(2-oxopyrrolidin-1-yl)propylamino]-4-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 137306931 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-[2-(2-hydroxy-5-methoxyphenyl)-6-[3-(2-oxopyrrolidin-1-yl)propylamino]-4-pyridinyl]benzonitrile |
| SMILES | COc1ccc(O)c(-c2cc(-c3ccc(C#N)cc3)cc(NCCCN3CCCC3=O)n2)c1 |
| InChI | InChI=1S/C26H26N4O3/c1-33-21-9-10-24(31)22(16-21)23-14-20(19-7-5-18(17-27)6-8-19)15-25(29-23)28-11-3-13-30-12-2-4-26(30)32/h5-10,14-16,31H,2-4,11-13H2,1H3,(H,28,29) |
| InChIKey | OZGAEPHPAGKCPT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|