C24H25ClFN3O2 — CID 137306796
2-[4-(2-chloro-6-fluorophenyl)-6-(3-morpholin-4-ylpropylamino)-2-pyridinyl]phenol (PubChem CID 137306796) has the molecular formula C24H25ClFN3O2 and a molecular weight of 441.93 g/mol. Its IUPAC name is 2-[4-(2-chloro-6-fluorophenyl)-6-(3-morpholin-4-ylpropylamino)-2-pyridinyl]phenol.
| Compound Name | 2-[4-(2-chloro-6-fluorophenyl)-6-(3-morpholin-4-ylpropylamino)-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 137306796 |
| Molecular Formula | C24H25ClFN3O2 |
| Molecular Weight | 441.93 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 2-[4-(2-chloro-6-fluorophenyl)-6-(3-morpholin-4-ylpropylamino)-2-pyridinyl]phenol |
| SMILES | Oc1ccccc1-c1cc(-c2c(F)cccc2Cl)cc(NCCCN2CCOCC2)n1 |
| InChI | InChI=1S/C24H25ClFN3O2/c25-19-6-3-7-20(26)24(19)17-15-21(18-5-1-2-8-22(18)30)28-23(16-17)27-9-4-10-29-11-13-31-14-12-29/h1-3,5-8,15-16,30H,4,9-14H2,(H,27,28) |
| InChIKey | KCFBZEXNRHLWTE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.93 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|