C21H19Cl2FN2O2 — CID 137306942
4-chloro-2-[4-(2-chloro-6-fluorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-5-methylphenol (PubChem CID 137306942) has the molecular formula C21H19Cl2FN2O2 and a molecular weight of 421.30 g/mol. Its IUPAC name is 4-chloro-2-[4-(2-chloro-6-fluorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-5-methylphenol.
| Compound Name | 4-chloro-2-[4-(2-chloro-6-fluorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-5-methylphenol |
|---|---|
| PubChem CID | 137306942 |
| Molecular Formula | C21H19Cl2FN2O2 |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 4-chloro-2-[4-(2-chloro-6-fluorophenyl)-6-(3-hydroxypropylamino)-2-pyridinyl]-5-methylphenol |
| SMILES | Cc1cc(O)c(-c2cc(-c3c(F)cccc3Cl)cc(NCCCO)n2)cc1Cl |
| InChI | InChI=1S/C21H19Cl2FN2O2/c1-12-8-19(28)14(11-16(12)23)18-9-13(10-20(26-18)25-6-3-7-27)21-15(22)4-2-5-17(21)24/h2,4-5,8-11,27-28H,3,6-7H2,1H3,(H,25,26) |
| InChIKey | ZRWZFUUYYCDTAW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|