C21H19ClN2O4 — CID 137307258
2-[4-(1,3-benzodioxol-4-yl)-6-(3-hydroxypropylamino)-2-pyridinyl]-4-chlorophenol (PubChem CID 137307258) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-4-yl)-6-(3-hydroxypropylamino)-2-pyridinyl]-4-chlorophenol.
| Compound Name | 2-[4-(1,3-benzodioxol-4-yl)-6-(3-hydroxypropylamino)-2-pyridinyl]-4-chlorophenol |
|---|---|
| PubChem CID | 137307258 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-4-yl)-6-(3-hydroxypropylamino)-2-pyridinyl]-4-chlorophenol |
| SMILES | OCCCNc1cc(-c2cccc3c2OCO3)cc(-c2cc(Cl)ccc2O)n1 |
| InChI | InChI=1S/C21H19ClN2O4/c22-14-5-6-18(26)16(11-14)17-9-13(10-20(24-17)23-7-2-8-25)15-3-1-4-19-21(15)28-12-27-19/h1,3-6,9-11,25-26H,2,7-8,12H2,(H,23,24) |
| InChIKey | PMIVEZBETPGVDL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|