C22H19BrN2O5 — CID 137290777
4-[[4-(1,3-benzodioxol-4-yl)-6-(5-bromo-2-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid (PubChem CID 137290777) has the molecular formula C22H19BrN2O5 and a molecular weight of 471.31 g/mol. Its IUPAC name is 4-[[4-(1,3-benzodioxol-4-yl)-6-(5-bromo-2-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid.
| Compound Name | 4-[[4-(1,3-benzodioxol-4-yl)-6-(5-bromo-2-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid |
|---|---|
| PubChem CID | 137290777 |
| Molecular Formula | C22H19BrN2O5 |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 4-[[4-(1,3-benzodioxol-4-yl)-6-(5-bromo-2-hydroxyphenyl)-2-pyridinyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1cc(-c2cccc3c2OCO3)cc(-c2cc(Br)ccc2O)n1 |
| InChI | InChI=1S/C22H19BrN2O5/c23-14-6-7-18(26)16(11-14)17-9-13(10-20(25-17)24-8-2-5-21(27)28)15-3-1-4-19-22(15)30-12-29-19/h1,3-4,6-7,9-11,26H,2,5,8,12H2,(H,24,25)(H,27,28) |
| InChIKey | ICBKXPVVBHBORD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|