C23H22N2O6 — CID 137307293
4-[[4-(1,3-benzodioxol-4-yl)-6-(4-hydroxy-3-methoxyphenyl)-2-pyridinyl]amino]butanoic acid (PubChem CID 137307293) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is 4-[[4-(1,3-benzodioxol-4-yl)-6-(4-hydroxy-3-methoxyphenyl)-2-pyridinyl]amino]butanoic acid.
| Compound Name | 4-[[4-(1,3-benzodioxol-4-yl)-6-(4-hydroxy-3-methoxyphenyl)-2-pyridinyl]amino]butanoic acid |
|---|---|
| PubChem CID | 137307293 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-[[4-(1,3-benzodioxol-4-yl)-6-(4-hydroxy-3-methoxyphenyl)-2-pyridinyl]amino]butanoic acid |
| SMILES | COc1cc(-c2cc(-c3cccc4c3OCO4)cc(NCCCC(=O)O)n2)ccc1O |
| InChI | InChI=1S/C23H22N2O6/c1-29-20-11-14(7-8-18(20)26)17-10-15(12-21(25-17)24-9-3-6-22(27)28)16-4-2-5-19-23(16)31-13-30-19/h2,4-5,7-8,10-12,26H,3,6,9,13H2,1H3,(H,24,25)(H,27,28) |
| InChIKey | IIYIFJKXTFJRQF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|