C20H20ClN3O5 — CID 166617858
4-[[6-chloro-2-(7-methoxy-1,3-benzodioxol-5-yl)-5-methylimidazo[1,2-a]pyridin-3-yl]amino]butanoic acid (PubChem CID 166617858) has the molecular formula C20H20ClN3O5 and a molecular weight of 417.85 g/mol. Its IUPAC name is 4-[[6-chloro-2-(7-methoxy-1,3-benzodioxol-5-yl)-5-methylimidazo[1,2-a]pyridin-3-yl]amino]butanoic acid.
| Compound Name | 4-[[6-chloro-2-(7-methoxy-1,3-benzodioxol-5-yl)-5-methylimidazo[1,2-a]pyridin-3-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 166617858 |
| Molecular Formula | C20H20ClN3O5 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 4-[[6-chloro-2-(7-methoxy-1,3-benzodioxol-5-yl)-5-methylimidazo[1,2-a]pyridin-3-yl]amino]butanoic acid |
| SMILES | COc1cc(-c2nc3ccc(Cl)c(C)n3c2NCCCC(=O)O)cc2c1OCO2 |
| InChI | InChI=1S/C20H20ClN3O5/c1-11-13(21)5-6-16-23-18(20(24(11)16)22-7-3-4-17(25)26)12-8-14(27-2)19-15(9-12)28-10-29-19/h5-6,8-9,22H,3-4,7,10H2,1-2H3,(H,25,26) |
| InChIKey | OHALNOQLZNMNLP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|