C13H15ClO4 — CID 117429748
4-(6-chloro-4-ethyl-1,3-benzodioxol-5-yl)butanoic acid (PubChem CID 117429748) has the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. Its IUPAC name is 4-(6-chloro-4-ethyl-1,3-benzodioxol-5-yl)butanoic acid.
| Compound Name | 4-(6-chloro-4-ethyl-1,3-benzodioxol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 117429748 |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(6-chloro-4-ethyl-1,3-benzodioxol-5-yl)butanoic acid |
| SMILES | CCc1c(CCCC(=O)O)c(Cl)cc2c1OCO2 |
| InChI | InChI=1S/C13H15ClO4/c1-2-8-9(4-3-5-12(15)16)10(14)6-11-13(8)18-7-17-11/h6H,2-5,7H2,1H3,(H,15,16) |
| InChIKey | YIPNTOLICTUKOA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |