C11H11ClO5 — CID 117400199
4-(7-chloro-6-hydroxy-1,3-benzodioxol-5-yl)butanoic acid (PubChem CID 117400199) has the molecular formula C11H11ClO5 and a molecular weight of 258.66 g/mol. Its IUPAC name is 4-(7-chloro-6-hydroxy-1,3-benzodioxol-5-yl)butanoic acid.
| Compound Name | 4-(7-chloro-6-hydroxy-1,3-benzodioxol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 117400199 |
| Molecular Formula | C11H11ClO5 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 4-(7-chloro-6-hydroxy-1,3-benzodioxol-5-yl)butanoic acid |
| SMILES | O=C(O)CCCc1cc2c(c(Cl)c1O)OCO2 |
| InChI | InChI=1S/C11H11ClO5/c12-9-10(15)6(2-1-3-8(13)14)4-7-11(9)17-5-16-7/h4,15H,1-3,5H2,(H,13,14) |
| InChIKey | SUVRYYJAZOTIER-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |