C9H8ClNO5 — CID 84705250
2-amino-2-(7-chloro-6-hydroxy-1,3-benzodioxol-5-yl)acetic acid (PubChem CID 84705250) has the molecular formula C9H8ClNO5 and a molecular weight of 245.62 g/mol. Its IUPAC name is 2-amino-2-(7-chloro-6-hydroxy-1,3-benzodioxol-5-yl)acetic acid.
| Compound Name | 2-amino-2-(7-chloro-6-hydroxy-1,3-benzodioxol-5-yl)acetic acid |
|---|---|
| PubChem CID | 84705250 |
| Molecular Formula | C9H8ClNO5 |
| Molecular Weight | 245.62 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 2-amino-2-(7-chloro-6-hydroxy-1,3-benzodioxol-5-yl)acetic acid |
| SMILES | NC(C(=O)O)c1cc2c(c(Cl)c1O)OCO2 |
| InChI | InChI=1S/C9H8ClNO5/c10-5-7(12)3(6(11)9(13)14)1-4-8(5)16-2-15-4/h1,6,12H,2,11H2,(H,13,14) |
| InChIKey | POTOZAMSAOJNJA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.62 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|