C11H13NO5 — CID 66510751
(2S)-2-amino-2-(6-ethoxy-1,3-benzodioxol-5-yl)acetic acid (PubChem CID 66510751) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is (2S)-2-amino-2-(6-ethoxy-1,3-benzodioxol-5-yl)acetic acid.
| Compound Name | (2S)-2-amino-2-(6-ethoxy-1,3-benzodioxol-5-yl)acetic acid |
|---|---|
| PubChem CID | 66510751 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (2S)-2-amino-2-(6-ethoxy-1,3-benzodioxol-5-yl)acetic acid |
| SMILES | CCOc1cc2c(cc1[C@H](N)C(=O)O)OCO2 |
| InChI | InChI=1S/C11H13NO5/c1-2-15-7-4-9-8(16-5-17-9)3-6(7)10(12)11(13)14/h3-4,10H,2,5,12H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | DXOHZCXDGWRBFY-JTQLQIEISA-N |
| XLogP | 0.90 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |