C11H15NO3 — CID 7016959
(2S)-2-amino-2-(2-ethoxy-5-methylphenyl)acetic acid (PubChem CID 7016959) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is (2S)-2-amino-2-(2-ethoxy-5-methylphenyl)acetic acid.
| Compound Name | (2S)-2-amino-2-(2-ethoxy-5-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 7016959 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (2S)-2-amino-2-(2-ethoxy-5-methylphenyl)acetic acid |
| SMILES | CCOc1ccc(C)cc1[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H15NO3/c1-3-15-9-5-4-7(2)6-8(9)10(12)11(13)14/h4-6,10H,3,12H2,1-2H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | ZSKJUPGBGBZLPK-JTQLQIEISA-N |
| XLogP | 1.48 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |