C12H16O4 — CID 170242933
2-[(6-propan-2-yl-1,3-benzodioxol-5-yl)oxy]ethanol (PubChem CID 170242933) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[(6-propan-2-yl-1,3-benzodioxol-5-yl)oxy]ethanol.
| Compound Name | 2-[(6-propan-2-yl-1,3-benzodioxol-5-yl)oxy]ethanol |
|---|---|
| PubChem CID | 170242933 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-[(6-propan-2-yl-1,3-benzodioxol-5-yl)oxy]ethanol |
| SMILES | CC(C)c1cc2c(cc1OCCO)OCO2 |
| InChI | InChI=1S/C12H16O4/c1-8(2)9-5-11-12(16-7-15-11)6-10(9)14-4-3-13/h5-6,8,13H,3-4,7H2,1-2H3 |
| InChIKey | ZKJAWJCEGHTWTJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |