C12H14O6 — CID 55011970
6-[2-(2-hydroxyethoxy)ethoxy]-1,3-benzodioxole-5-carbaldehyde (PubChem CID 55011970) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is 6-[2-(2-hydroxyethoxy)ethoxy]-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-[2-(2-hydroxyethoxy)ethoxy]-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 55011970 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 6-[2-(2-hydroxyethoxy)ethoxy]-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=Cc1cc2c(cc1OCCOCCO)OCO2 |
| InChI | InChI=1S/C12H14O6/c13-1-2-15-3-4-16-10-6-12-11(17-8-18-12)5-9(10)7-14/h5-7,13H,1-4,8H2 |
| InChIKey | JGCHYKRAIHQYMA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|