C11H10O6 — CID 55012112
methyl 2-[(6-formyl-1,3-benzodioxol-5-yl)oxy]acetate (PubChem CID 55012112) has the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. Its IUPAC name is methyl 2-[(6-formyl-1,3-benzodioxol-5-yl)oxy]acetate.
| Compound Name | methyl 2-[(6-formyl-1,3-benzodioxol-5-yl)oxy]acetate |
|---|---|
| PubChem CID | 55012112 |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | methyl 2-[(6-formyl-1,3-benzodioxol-5-yl)oxy]acetate |
| SMILES | COC(=O)COc1cc2c(cc1C=O)OCO2 |
| InChI | InChI=1S/C11H10O6/c1-14-11(13)5-15-8-3-10-9(16-6-17-10)2-7(8)4-12/h2-4H,5-6H2,1H3 |
| InChIKey | ZNFFIRWQHDZAPI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|