C15H19NO5 — CID 47984184
2-[(6-formyl-1,3-benzodioxol-5-yl)oxy]-N-pentan-3-ylacetamide (PubChem CID 47984184) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-[(6-formyl-1,3-benzodioxol-5-yl)oxy]-N-pentan-3-ylacetamide.
| Compound Name | 2-[(6-formyl-1,3-benzodioxol-5-yl)oxy]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 47984184 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-[(6-formyl-1,3-benzodioxol-5-yl)oxy]-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)COc1cc2c(cc1C=O)OCO2 |
| InChI | InChI=1S/C15H19NO5/c1-3-11(4-2)16-15(18)8-19-12-6-14-13(20-9-21-14)5-10(12)7-17/h5-7,11H,3-4,8-9H2,1-2H3,(H,16,18) |
| InChIKey | KVTIPSMRYQDGQF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|