C13H14O6 — CID 55011774
methyl 4-[(6-formyl-1,3-benzodioxol-5-yl)oxy]butanoate (PubChem CID 55011774) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is methyl 4-[(6-formyl-1,3-benzodioxol-5-yl)oxy]butanoate.
| Compound Name | methyl 4-[(6-formyl-1,3-benzodioxol-5-yl)oxy]butanoate |
|---|---|
| PubChem CID | 55011774 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | methyl 4-[(6-formyl-1,3-benzodioxol-5-yl)oxy]butanoate |
| SMILES | COC(=O)CCCOc1cc2c(cc1C=O)OCO2 |
| InChI | InChI=1S/C13H14O6/c1-16-13(15)3-2-4-17-10-6-12-11(18-8-19-12)5-9(10)7-14/h5-7H,2-4,8H2,1H3 |
| InChIKey | LBOHDQSLNNINQD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|