C15H21NO5 — CID 63949508
methyl 3-[[6-(propylaminomethyl)-1,3-benzodioxol-5-yl]oxy]propanoate (PubChem CID 63949508) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 3-[[6-(propylaminomethyl)-1,3-benzodioxol-5-yl]oxy]propanoate.
| Compound Name | methyl 3-[[6-(propylaminomethyl)-1,3-benzodioxol-5-yl]oxy]propanoate |
|---|---|
| PubChem CID | 63949508 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | methyl 3-[[6-(propylaminomethyl)-1,3-benzodioxol-5-yl]oxy]propanoate |
| SMILES | CCCNCc1cc2c(cc1OCCC(=O)OC)OCO2 |
| InChI | InChI=1S/C15H21NO5/c1-3-5-16-9-11-7-13-14(21-10-20-13)8-12(11)19-6-4-15(17)18-2/h7-8,16H,3-6,9-10H2,1-2H3 |
| InChIKey | PREBUSBOZLZZEO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|