C15H20O6 — CID 107263272
6-(3-butoxy-2-hydroxypropoxy)-1,3-benzodioxole-5-carbaldehyde (PubChem CID 107263272) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is 6-(3-butoxy-2-hydroxypropoxy)-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-(3-butoxy-2-hydroxypropoxy)-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 107263272 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 6-(3-butoxy-2-hydroxypropoxy)-1,3-benzodioxole-5-carbaldehyde |
| SMILES | CCCCOCC(O)COc1cc2c(cc1C=O)OCO2 |
| InChI | InChI=1S/C15H20O6/c1-2-3-4-18-8-12(17)9-19-13-6-15-14(20-10-21-15)5-11(13)7-16/h5-7,12,17H,2-4,8-10H2,1H3 |
| InChIKey | NMQXZJIARUHNJC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|