C11H16N2O3 — CID 66517333
(1R)-1-(6-ethoxy-1,3-benzodioxol-5-yl)ethane-1,2-diamine (PubChem CID 66517333) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is (1R)-1-(6-ethoxy-1,3-benzodioxol-5-yl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(6-ethoxy-1,3-benzodioxol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517333 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (1R)-1-(6-ethoxy-1,3-benzodioxol-5-yl)ethane-1,2-diamine |
| SMILES | CCOc1cc2c(cc1[C@@H](N)CN)OCO2 |
| InChI | InChI=1S/C11H16N2O3/c1-2-14-9-4-11-10(15-6-16-11)3-7(9)8(13)5-12/h3-4,8H,2,5-6,12-13H2,1H3/t8-/m0/s1 |
| InChIKey | BXKVPDCDBWCKIG-QMMMGPOBSA-N |
| XLogP | 0.77 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |