C12H20N2O2 — CID 77131156
1-(2,5-diethoxyphenyl)ethane-1,2-diamine (PubChem CID 77131156) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)ethane-1,2-diamine.
| Compound Name | 1-(2,5-diethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 77131156 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)ethane-1,2-diamine |
| SMILES | CCOc1ccc(OCC)c(C(N)CN)c1 |
| InChI | InChI=1S/C12H20N2O2/c1-3-15-9-5-6-12(16-4-2)10(7-9)11(14)8-13/h5-7,11H,3-4,8,13-14H2,1-2H3 |
| InChIKey | TXVAHMOUDQLKJA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |