C12H20N2O — CID 66516824
1-(2-ethoxy-4,5-dimethylphenyl)ethane-1,2-diamine (PubChem CID 66516824) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(2-ethoxy-4,5-dimethylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(2-ethoxy-4,5-dimethylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66516824 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(2-ethoxy-4,5-dimethylphenyl)ethane-1,2-diamine |
| SMILES | CCOc1cc(C)c(C)cc1C(N)CN |
| InChI | InChI=1S/C12H20N2O/c1-4-15-12-6-9(3)8(2)5-10(12)11(14)7-13/h5-6,11H,4,7,13-14H2,1-3H3 |
| InChIKey | WYACTMVSOXBKEI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |