C13H22N2O — CID 66517345
1-(4,5-dimethyl-2-propoxyphenyl)ethane-1,2-diamine (PubChem CID 66517345) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-propoxyphenyl)ethane-1,2-diamine.
| Compound Name | 1-(4,5-dimethyl-2-propoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517345 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(4,5-dimethyl-2-propoxyphenyl)ethane-1,2-diamine |
| SMILES | CCCOc1cc(C)c(C)cc1C(N)CN |
| InChI | InChI=1S/C13H22N2O/c1-4-5-16-13-7-10(3)9(2)6-11(13)12(15)8-14/h6-7,12H,4-5,8,14-15H2,1-3H3 |
| InChIKey | OQRIWIDQHYENGT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |