C17H29NO3 — CID 83942792
2-(aminomethyl)-4-(2,5-diethoxyphenyl)hexan-1-ol (PubChem CID 83942792) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is 2-(aminomethyl)-4-(2,5-diethoxyphenyl)hexan-1-ol.
| Compound Name | 2-(aminomethyl)-4-(2,5-diethoxyphenyl)hexan-1-ol |
|---|---|
| PubChem CID | 83942792 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 2-(aminomethyl)-4-(2,5-diethoxyphenyl)hexan-1-ol |
| SMILES | CCOc1ccc(OCC)c(C(CC)CC(CN)CO)c1 |
| InChI | InChI=1S/C17H29NO3/c1-4-14(9-13(11-18)12-19)16-10-15(20-5-2)7-8-17(16)21-6-3/h7-8,10,13-14,19H,4-6,9,11-12,18H2,1-3H3 |
| InChIKey | PIJDBQMQHRPLLI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |