C17H29ClN2O2 — CID 83943408
2-[2-(5-chloro-2,4-diethoxyphenyl)butyl]propane-1,3-diamine (PubChem CID 83943408) has the molecular formula C17H29ClN2O2 and a molecular weight of 328.88 g/mol. Its IUPAC name is 2-[2-(5-chloro-2,4-diethoxyphenyl)butyl]propane-1,3-diamine.
| Compound Name | 2-[2-(5-chloro-2,4-diethoxyphenyl)butyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 83943408 |
| Molecular Formula | C17H29ClN2O2 |
| Molecular Weight | 328.88 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-[2-(5-chloro-2,4-diethoxyphenyl)butyl]propane-1,3-diamine |
| SMILES | CCOc1cc(OCC)c(C(CC)CC(CN)CN)cc1Cl |
| InChI | InChI=1S/C17H29ClN2O2/c1-4-13(7-12(10-19)11-20)14-8-15(18)17(22-6-3)9-16(14)21-5-2/h8-9,12-13H,4-7,10-11,19-20H2,1-3H3 |
| InChIKey | WKQUKRBOPFZZMX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |