C15H25ClN2 — CID 83931457
2-[2-(2-chloro-4,5-dimethylphenyl)butyl]propane-1,3-diamine (PubChem CID 83931457) has the molecular formula C15H25ClN2 and a molecular weight of 268.83 g/mol. Its IUPAC name is 2-[2-(2-chloro-4,5-dimethylphenyl)butyl]propane-1,3-diamine.
| Compound Name | 2-[2-(2-chloro-4,5-dimethylphenyl)butyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 83931457 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-[2-(2-chloro-4,5-dimethylphenyl)butyl]propane-1,3-diamine |
| SMILES | CCC(CC(CN)CN)c1cc(C)c(C)cc1Cl |
| InChI | InChI=1S/C15H25ClN2/c1-4-13(7-12(8-17)9-18)14-5-10(2)11(3)6-15(14)16/h5-6,12-13H,4,7-9,17-18H2,1-3H3 |
| InChIKey | HYTQRAGKWRRAJB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |