C14H21ClO2 — CID 83931558
4-(2-chloro-4,5-dimethylphenyl)hexane-1,2-diol (PubChem CID 83931558) has the molecular formula C14H21ClO2 and a molecular weight of 256.77 g/mol. Its IUPAC name is 4-(2-chloro-4,5-dimethylphenyl)hexane-1,2-diol.
| Compound Name | 4-(2-chloro-4,5-dimethylphenyl)hexane-1,2-diol |
|---|---|
| PubChem CID | 83931558 |
| Molecular Formula | C14H21ClO2 |
| Molecular Weight | 256.77 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-(2-chloro-4,5-dimethylphenyl)hexane-1,2-diol |
| SMILES | CCC(CC(O)CO)c1cc(C)c(C)cc1Cl |
| InChI | InChI=1S/C14H21ClO2/c1-4-11(7-12(17)8-16)13-5-9(2)10(3)6-14(13)15/h5-6,11-12,16-17H,4,7-8H2,1-3H3 |
| InChIKey | DEDZJQJOLHTKSX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |