C15H23ClO5 — CID 83925663
4-(5-chloro-2,3,4-trimethoxyphenyl)hexane-1,2-diol (PubChem CID 83925663) has the molecular formula C15H23ClO5 and a molecular weight of 318.80 g/mol. Its IUPAC name is 4-(5-chloro-2,3,4-trimethoxyphenyl)hexane-1,2-diol.
| Compound Name | 4-(5-chloro-2,3,4-trimethoxyphenyl)hexane-1,2-diol |
|---|---|
| PubChem CID | 83925663 |
| Molecular Formula | C15H23ClO5 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-(5-chloro-2,3,4-trimethoxyphenyl)hexane-1,2-diol |
| SMILES | CCC(CC(O)CO)c1cc(Cl)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C15H23ClO5/c1-5-9(6-10(18)8-17)11-7-12(16)14(20-3)15(21-4)13(11)19-2/h7,9-10,17-18H,5-6,8H2,1-4H3 |
| InChIKey | DRHYPJQJQXLDQK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |