C12H15Cl3O2 — CID 83925200
4-(2,3,6-trichlorophenyl)hexane-1,2-diol (PubChem CID 83925200) has the molecular formula C12H15Cl3O2 and a molecular weight of 297.61 g/mol. Its IUPAC name is 4-(2,3,6-trichlorophenyl)hexane-1,2-diol.
| Compound Name | 4-(2,3,6-trichlorophenyl)hexane-1,2-diol |
|---|---|
| PubChem CID | 83925200 |
| Molecular Formula | C12H15Cl3O2 |
| Molecular Weight | 297.61 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 4-(2,3,6-trichlorophenyl)hexane-1,2-diol |
| SMILES | CCC(CC(O)CO)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C12H15Cl3O2/c1-2-7(5-8(17)6-16)11-9(13)3-4-10(14)12(11)15/h3-4,7-8,16-17H,2,5-6H2,1H3 |
| InChIKey | CZRZSXFGIKVMSL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|