C12H20O2S — CID 83929463
4-(5-ethylthiophen-2-yl)hexane-1,2-diol (PubChem CID 83929463) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is 4-(5-ethylthiophen-2-yl)hexane-1,2-diol.
| Compound Name | 4-(5-ethylthiophen-2-yl)hexane-1,2-diol |
|---|---|
| PubChem CID | 83929463 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 4-(5-ethylthiophen-2-yl)hexane-1,2-diol |
| SMILES | CCc1ccc(C(CC)CC(O)CO)s1 |
| InChI | InChI=1S/C12H20O2S/c1-3-9(7-10(14)8-13)12-6-5-11(4-2)15-12/h5-6,9-10,13-14H,3-4,7-8H2,1-2H3 |
| InChIKey | MJSRRKMNBYXHMS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |