C15H27NOS — CID 83929636
2-(aminomethyl)-4-[5-(2-methylpropyl)thiophen-2-yl]hexan-1-ol (PubChem CID 83929636) has the molecular formula C15H27NOS and a molecular weight of 269.45 g/mol. Its IUPAC name is 2-(aminomethyl)-4-[5-(2-methylpropyl)thiophen-2-yl]hexan-1-ol.
| Compound Name | 2-(aminomethyl)-4-[5-(2-methylpropyl)thiophen-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 83929636 |
| Molecular Formula | C15H27NOS |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-(aminomethyl)-4-[5-(2-methylpropyl)thiophen-2-yl]hexan-1-ol |
| SMILES | CCC(CC(CN)CO)c1ccc(CC(C)C)s1 |
| InChI | InChI=1S/C15H27NOS/c1-4-13(8-12(9-16)10-17)15-6-5-14(18-15)7-11(2)3/h5-6,11-13,17H,4,7-10,16H2,1-3H3 |
| InChIKey | ZNHONKMXXGUDDQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |