C17H29NO — CID 83941407
2-(aminomethyl)-4-(2,3,5,6-tetramethylphenyl)hexan-1-ol (PubChem CID 83941407) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 2-(aminomethyl)-4-(2,3,5,6-tetramethylphenyl)hexan-1-ol.
| Compound Name | 2-(aminomethyl)-4-(2,3,5,6-tetramethylphenyl)hexan-1-ol |
|---|---|
| PubChem CID | 83941407 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-(aminomethyl)-4-(2,3,5,6-tetramethylphenyl)hexan-1-ol |
| SMILES | CCC(CC(CN)CO)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C17H29NO/c1-6-16(8-15(9-18)10-19)17-13(4)11(2)7-12(3)14(17)5/h7,15-16,19H,6,8-10,18H2,1-5H3 |
| InChIKey | SKPHWWVXLMKJRB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |