C13H23NOS — CID 65187875
2-(aminomethyl)-1-(5-ethylthiophen-2-yl)-4-methylpentan-1-ol (PubChem CID 65187875) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(5-ethylthiophen-2-yl)-4-methylpentan-1-ol.
| Compound Name | 2-(aminomethyl)-1-(5-ethylthiophen-2-yl)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 65187875 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-(aminomethyl)-1-(5-ethylthiophen-2-yl)-4-methylpentan-1-ol |
| SMILES | CCc1ccc(C(O)C(CN)CC(C)C)s1 |
| InChI | InChI=1S/C13H23NOS/c1-4-11-5-6-12(16-11)13(15)10(8-14)7-9(2)3/h5-6,9-10,13,15H,4,7-8,14H2,1-3H3 |
| InChIKey | JKMCOJDNASJVDN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |