C12H22N2S — CID 105298469
[1-(5-ethylthiophen-2-yl)-3-methylpentyl]hydrazine (PubChem CID 105298469) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is [1-(5-ethylthiophen-2-yl)-3-methylpentyl]hydrazine.
| Compound Name | [1-(5-ethylthiophen-2-yl)-3-methylpentyl]hydrazine |
|---|---|
| PubChem CID | 105298469 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | [1-(5-ethylthiophen-2-yl)-3-methylpentyl]hydrazine |
| SMILES | CCc1ccc(C(CC(C)CC)NN)s1 |
| InChI | InChI=1S/C12H22N2S/c1-4-9(3)8-11(14-13)12-7-6-10(5-2)15-12/h6-7,9,11,14H,4-5,8,13H2,1-3H3 |
| InChIKey | FNVKACMSTTUHOL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|