C12H18O3S — CID 62942751
5-(5-ethylthiophen-2-yl)-5-hydroxy-3-methylpentanoic acid (PubChem CID 62942751) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is 5-(5-ethylthiophen-2-yl)-5-hydroxy-3-methylpentanoic acid.
| Compound Name | 5-(5-ethylthiophen-2-yl)-5-hydroxy-3-methylpentanoic acid |
|---|---|
| PubChem CID | 62942751 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 5-(5-ethylthiophen-2-yl)-5-hydroxy-3-methylpentanoic acid |
| SMILES | CCc1ccc(C(O)CC(C)CC(=O)O)s1 |
| InChI | InChI=1S/C12H18O3S/c1-3-9-4-5-11(16-9)10(13)6-8(2)7-12(14)15/h4-5,8,10,13H,3,6-7H2,1-2H3,(H,14,15) |
| InChIKey | NMPSGYDXEISWLQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |