C8H13NOS — CID 62345942
2-amino-2-(5-ethylthiophen-2-yl)ethanol (PubChem CID 62345942) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is 2-amino-2-(5-ethylthiophen-2-yl)ethanol.
| Compound Name | 2-amino-2-(5-ethylthiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 62345942 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 2-amino-2-(5-ethylthiophen-2-yl)ethanol |
| SMILES | CCc1ccc(C(N)CO)s1 |
| InChI | InChI=1S/C8H13NOS/c1-2-6-3-4-8(11-6)7(9)5-10/h3-4,7,10H,2,5,9H2,1H3 |
| InChIKey | IEWATRQQRCSZFF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |