C9H13F2NS — CID 171313876
(1R)-1-(5-ethylthiophen-2-yl)-3,3-difluoropropan-1-amine (PubChem CID 171313876) has the molecular formula C9H13F2NS and a molecular weight of 205.27 g/mol. Its IUPAC name is (1R)-1-(5-ethylthiophen-2-yl)-3,3-difluoropropan-1-amine.
| Compound Name | (1R)-1-(5-ethylthiophen-2-yl)-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 171313876 |
| Molecular Formula | C9H13F2NS |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (1R)-1-(5-ethylthiophen-2-yl)-3,3-difluoropropan-1-amine |
| SMILES | CCc1ccc([C@H](N)CC(F)F)s1 |
| InChI | InChI=1S/C9H13F2NS/c1-2-6-3-4-8(13-6)7(12)5-9(10)11/h3-4,7,9H,2,5,12H2,1H3/t7-/m1/s1 |
| InChIKey | LTKYGONOTIKJNB-SSDOTTSWSA-N |
| XLogP | 2.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |