C11H17NO2S — CID 60860643
methyl 4-amino-4-(5-ethylthiophen-2-yl)butanoate (PubChem CID 60860643) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is methyl 4-amino-4-(5-ethylthiophen-2-yl)butanoate.
| Compound Name | methyl 4-amino-4-(5-ethylthiophen-2-yl)butanoate |
|---|---|
| PubChem CID | 60860643 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | methyl 4-amino-4-(5-ethylthiophen-2-yl)butanoate |
| SMILES | CCc1ccc(C(N)CCC(=O)OC)s1 |
| InChI | InChI=1S/C11H17NO2S/c1-3-8-4-6-10(15-8)9(12)5-7-11(13)14-2/h4,6,9H,3,5,7,12H2,1-2H3 |
| InChIKey | PADNKASEWHDNKO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |