C14H22O2 — CID 83922430
4-(3,5-dimethylphenyl)hexane-1,2-diol (PubChem CID 83922430) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)hexane-1,2-diol.
| Compound Name | 4-(3,5-dimethylphenyl)hexane-1,2-diol |
|---|---|
| PubChem CID | 83922430 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 4-(3,5-dimethylphenyl)hexane-1,2-diol |
| SMILES | CCC(CC(O)CO)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H22O2/c1-4-12(8-14(16)9-15)13-6-10(2)5-11(3)7-13/h5-7,12,14-16H,4,8-9H2,1-3H3 |
| InChIKey | OQBSOEOLGYZCHU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |