C17H28O3 — CID 83939525
4-(4-ethoxy-2,3,6-trimethylphenyl)hexane-1,2-diol (PubChem CID 83939525) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 4-(4-ethoxy-2,3,6-trimethylphenyl)hexane-1,2-diol.
| Compound Name | 4-(4-ethoxy-2,3,6-trimethylphenyl)hexane-1,2-diol |
|---|---|
| PubChem CID | 83939525 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 4-(4-ethoxy-2,3,6-trimethylphenyl)hexane-1,2-diol |
| SMILES | CCOc1cc(C)c(C(CC)CC(O)CO)c(C)c1C |
| InChI | InChI=1S/C17H28O3/c1-6-14(9-15(19)10-18)17-11(3)8-16(20-7-2)12(4)13(17)5/h8,14-15,18-19H,6-7,9-10H2,1-5H3 |
| InChIKey | LYQJQHHMWCAKOG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |