C16H26O3 — CID 83939523
4-(4-ethoxy-2,3,6-trimethylphenyl)pentane-1,2-diol (PubChem CID 83939523) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-(4-ethoxy-2,3,6-trimethylphenyl)pentane-1,2-diol.
| Compound Name | 4-(4-ethoxy-2,3,6-trimethylphenyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 83939523 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 4-(4-ethoxy-2,3,6-trimethylphenyl)pentane-1,2-diol |
| SMILES | CCOc1cc(C)c(C(C)CC(O)CO)c(C)c1C |
| InChI | InChI=1S/C16H26O3/c1-6-19-15-8-11(3)16(13(5)12(15)4)10(2)7-14(18)9-17/h8,10,14,17-18H,6-7,9H2,1-5H3 |
| InChIKey | VLXNCHMRCIAQIS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |