C18H31NO2 — CID 83939393
5-amino-2-(4-methoxy-2,3,6-trimethylphenyl)octan-4-ol (PubChem CID 83939393) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 5-amino-2-(4-methoxy-2,3,6-trimethylphenyl)octan-4-ol.
| Compound Name | 5-amino-2-(4-methoxy-2,3,6-trimethylphenyl)octan-4-ol |
|---|---|
| PubChem CID | 83939393 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 5-amino-2-(4-methoxy-2,3,6-trimethylphenyl)octan-4-ol |
| SMILES | CCCC(N)C(O)CC(C)c1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C18H31NO2/c1-7-8-15(19)16(20)9-11(2)18-12(3)10-17(21-6)13(4)14(18)5/h10-11,15-16,20H,7-9,19H2,1-6H3 |
| InChIKey | ZRFDFCVJRNHRBF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |