C17H29NO2 — CID 83939390
5-amino-2-(4-methoxy-2,3,6-trimethylphenyl)heptan-4-ol (PubChem CID 83939390) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 5-amino-2-(4-methoxy-2,3,6-trimethylphenyl)heptan-4-ol.
| Compound Name | 5-amino-2-(4-methoxy-2,3,6-trimethylphenyl)heptan-4-ol |
|---|---|
| PubChem CID | 83939390 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 5-amino-2-(4-methoxy-2,3,6-trimethylphenyl)heptan-4-ol |
| SMILES | CCC(N)C(O)CC(C)c1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C17H29NO2/c1-7-14(18)15(19)8-10(2)17-11(3)9-16(20-6)12(4)13(17)5/h9-10,14-15,19H,7-8,18H2,1-6H3 |
| InChIKey | JPWQDVYSKXYWIA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |