About methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate
methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate (PubChem CID 116940176) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate.
Analyze methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate?
The IUPAC name of methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate (CID 116940176) is methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate.
What is the SMILES notation for methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate?
The canonical SMILES for methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate is COC(=O)CC(N)c1c(C)cc(OC)c(C)c1C.
What is the InChIKey of methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate?
The InChIKey is GJLCGBMFAANYDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-8-6-12(17-4)9(2)10(3)14(8)11(15)7-13(16)18-5/h6,11H,7,15H2,1-5H3.
What are the key properties of methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate?
methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate has a molecular weight of 251.33 g/mol, XLogP of 2.18, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-3-(4-methoxy-2,3,6-trimethylphenyl)propanoate is sourced from PubChem (CID 116940176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).