C12H18ClNO5 — CID 171248754
methyl (3R)-3-amino-3-(2-hydroxy-4,6-dimethoxyphenyl)propanoate;hydrochloride (PubChem CID 171248754) has the molecular formula C12H18ClNO5 and a molecular weight of 291.73 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(2-hydroxy-4,6-dimethoxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(2-hydroxy-4,6-dimethoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171248754 |
| Molecular Formula | C12H18ClNO5 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | methyl (3R)-3-amino-3-(2-hydroxy-4,6-dimethoxyphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@@H](N)c1c(O)cc(OC)cc1OC.Cl |
| InChI | InChI=1S/C12H17NO5.ClH/c1-16-7-4-9(14)12(10(5-7)17-2)8(13)6-11(15)18-3;/h4-5,8,14H,6,13H2,1-3H3;1H/t8-;/m1./s1 |
| InChIKey | XQWVPDTYJYLYQH-DDWIOCJRSA-N |
| XLogP | 1.39 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|