C12H18ClNO3 — CID 171207086
2-[(1R)-1-aminobut-3-enyl]-3,5-dimethoxyphenol;hydrochloride (PubChem CID 171207086) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 2-[(1R)-1-aminobut-3-enyl]-3,5-dimethoxyphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-aminobut-3-enyl]-3,5-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171207086 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-[(1R)-1-aminobut-3-enyl]-3,5-dimethoxyphenol;hydrochloride |
| SMILES | C=CC[C@@H](N)c1c(O)cc(OC)cc1OC.Cl |
| InChI | InChI=1S/C12H17NO3.ClH/c1-4-5-9(13)12-10(14)6-8(15-2)7-11(12)16-3;/h4,6-7,9,14H,1,5,13H2,2-3H3;1H/t9-;/m1./s1 |
| InChIKey | XVZCQCFMQHHWFO-SBSPUUFOSA-N |
| XLogP | 2.41 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|